C29H32N4O2 — CID 59641890
1-(4-butylphenyl)-3-[2-[4-(4-methoxyphenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]urea (PubChem CID 59641890) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[2-[4-(4-methoxyphenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]urea.
| Compound Name | 1-(4-butylphenyl)-3-[2-[4-(4-methoxyphenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]urea |
|---|---|
| PubChem CID | 59641890 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 1-(4-butylphenyl)-3-[2-[4-(4-methoxyphenyl)-2-phenyl-1H-imidazol-5-yl]ethyl]urea |
| SMILES | CCCCc1ccc(NC(=O)NCCc2[nH]c(-c3ccccc3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H32N4O2/c1-3-4-8-21-11-15-24(16-12-21)31-29(34)30-20-19-26-27(22-13-17-25(35-2)18-14-22)33-28(32-26)23-9-6-5-7-10-23/h5-7,9-18H,3-4,8,19-20H2,1-2H3,(H,32,33)(H2,30,31,34) |
| InChIKey | GPPADBKHHYQDFV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |