C20H24N2O2 — CID 59643693
3-hydroxy-N-(2,4,6-trimethyl-3-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 59643693) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 3-hydroxy-N-(2,4,6-trimethyl-3-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 3-hydroxy-N-(2,4,6-trimethyl-3-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 59643693 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 3-hydroxy-N-(2,4,6-trimethyl-3-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | Cc1cc(C)c(N2CCCC2)c(C)c1NC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C20H24N2O2/c1-13-11-14(2)19(22-9-4-5-10-22)15(3)18(13)21-20(24)16-7-6-8-17(23)12-16/h6-8,11-12,23H,4-5,9-10H2,1-3H3,(H,21,24) |
| InChIKey | NYVFCHDDGPJUNY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |