C21H27ClN2O — CID 88566002
2-chloro-N-(2,4,6-trimethyl-3-pyrrolidin-1-ylphenyl)cyclohepta-1,5-diene-1-carboxamide (PubChem CID 88566002) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is 2-chloro-N-(2,4,6-trimethyl-3-pyrrolidin-1-ylphenyl)cyclohepta-1,5-diene-1-carboxamide.
| Compound Name | 2-chloro-N-(2,4,6-trimethyl-3-pyrrolidin-1-ylphenyl)cyclohepta-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 88566002 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-chloro-N-(2,4,6-trimethyl-3-pyrrolidin-1-ylphenyl)cyclohepta-1,5-diene-1-carboxamide |
| SMILES | Cc1cc(C)c(N2CCCC2)c(C)c1NC(=O)C1=C(Cl)CCC=CC1 |
| InChI | InChI=1S/C21H27ClN2O/c1-14-13-15(2)20(24-11-7-8-12-24)16(3)19(14)23-21(25)17-9-5-4-6-10-18(17)22/h4-5,13H,6-12H2,1-3H3,(H,23,25) |
| InChIKey | HADILYPFFDVHKW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|