C31H32BFN2O4 — CID 59643943
4-[(3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-2-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidin-1-yl]benzonitrile (PubChem CID 59643943) has the molecular formula C31H32BFN2O4 and a molecular weight of 526.42 g/mol. Its IUPAC name is 4-[(3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-2-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidin-1-yl]benzonitrile.
| Compound Name | 4-[(3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-2-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 59643943 |
| Molecular Formula | C31H32BFN2O4 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 4-[(3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-2-oxo-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]azetidin-1-yl]benzonitrile |
| SMILES | CC1(C)OB(c2ccc([C@@H]3[C@@H](CC[C@H](O)c4ccc(F)cc4)C(=O)N3c3ccc(C#N)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C31H32BFN2O4/c1-30(2)31(3,4)39-32(38-30)23-11-7-22(8-12-23)28-26(17-18-27(36)21-9-13-24(33)14-10-21)29(37)35(28)25-15-5-20(19-34)6-16-25/h5-16,26-28,36H,17-18H2,1-4H3/t26-,27+,28-/m1/s1 |
| InChIKey | VFTHBOIGMCKBCB-OZNIXHKMSA-N |
| XLogP | 5.21 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|