C20H40O2 — CID 59645062
2-[1-(5,6-dimethyloctan-2-yloxy)ethoxy]ethylcyclohexane (PubChem CID 59645062) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 2-[1-(5,6-dimethyloctan-2-yloxy)ethoxy]ethylcyclohexane.
| Compound Name | 2-[1-(5,6-dimethyloctan-2-yloxy)ethoxy]ethylcyclohexane |
|---|---|
| PubChem CID | 59645062 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 2-[1-(5,6-dimethyloctan-2-yloxy)ethoxy]ethylcyclohexane |
| SMILES | CCC(C)C(C)CCC(C)OC(C)OCCC1CCCCC1 |
| InChI | InChI=1S/C20H40O2/c1-6-16(2)17(3)12-13-18(4)22-19(5)21-15-14-20-10-8-7-9-11-20/h16-20H,6-15H2,1-5H3 |
| InChIKey | WUFNNOPSQJKAIA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|