C34H20F5N5 — CID 59646103
2-(2,4-difluoro-3-isocyanophenyl)-6-[diphenyl-[6-[3-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]methyl]pyridine (PubChem CID 59646103) has the molecular formula C34H20F5N5 and a molecular weight of 593.56 g/mol. Its IUPAC name is 2-(2,4-difluoro-3-isocyanophenyl)-6-[diphenyl-[6-[3-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]methyl]pyridine.
| Compound Name | 2-(2,4-difluoro-3-isocyanophenyl)-6-[diphenyl-[6-[3-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]methyl]pyridine |
|---|---|
| PubChem CID | 59646103 |
| Molecular Formula | C34H20F5N5 |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | 2-(2,4-difluoro-3-isocyanophenyl)-6-[diphenyl-[6-[3-(trifluoromethyl)pyrazol-1-yl]-2-pyridinyl]methyl]pyridine |
| SMILES | [C-]#[N+]c1c(F)ccc(-c2cccc(C(c3ccccc3)(c3ccccc3)c3cccc(-n4ccc(C(F)(F)F)n4)n3)n2)c1F |
| InChI | InChI=1S/C34H20F5N5/c1-40-32-25(35)19-18-24(31(32)36)26-14-8-15-27(41-26)33(22-10-4-2-5-11-22,23-12-6-3-7-13-23)28-16-9-17-30(42-28)44-21-20-29(43-44)34(37,38)39/h2-21H |
| InChIKey | VZYRCNZROMRBEZ-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|