C37H18F4N4 — CID 140958340
2-(2,4-difluoro-3-isocyanophenyl)-6-[9-[6-(2,4-difluoro-3-isocyanophenyl)-2-pyridinyl]fluoren-9-yl]pyridine (PubChem CID 140958340) has the molecular formula C37H18F4N4 and a molecular weight of 594.57 g/mol. Its IUPAC name is 2-(2,4-difluoro-3-isocyanophenyl)-6-[9-[6-(2,4-difluoro-3-isocyanophenyl)-2-pyridinyl]fluoren-9-yl]pyridine.
| Compound Name | 2-(2,4-difluoro-3-isocyanophenyl)-6-[9-[6-(2,4-difluoro-3-isocyanophenyl)-2-pyridinyl]fluoren-9-yl]pyridine |
|---|---|
| PubChem CID | 140958340 |
| Molecular Formula | C37H18F4N4 |
| Molecular Weight | 594.57 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | 2-(2,4-difluoro-3-isocyanophenyl)-6-[9-[6-(2,4-difluoro-3-isocyanophenyl)-2-pyridinyl]fluoren-9-yl]pyridine |
| SMILES | [C-]#[N+]c1c(F)ccc(-c2cccc(C3(c4cccc(-c5ccc(F)c([N+]#[C-])c5F)n4)c4ccccc4-c4ccccc43)n2)c1F |
| InChI | InChI=1S/C37H18F4N4/c1-42-35-27(38)19-17-23(33(35)40)29-13-7-15-31(44-29)37(25-11-5-3-9-21(25)22-10-4-6-12-26(22)37)32-16-8-14-30(45-32)24-18-20-28(39)36(43-2)34(24)41/h3-20H |
| InChIKey | PGZULBWZQWPAJO-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 34.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.57 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|