About 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one
10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one (PubChem CID 89409704) has the molecular formula C24H14Br2N2O
and a molecular weight of 506.20 g/mol. Its IUPAC name is 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one.
Molecular Properties
| Compound Name | 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one |
| PubChem CID | 89409704 |
| Molecular Formula | C24H14Br2N2O |
| Molecular Weight | 506.20 g/mol |
| Exact Mass | 503.95 |
| IUPAC Name | 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one |
| SMILES | O=C1c2ccccc2C(c2cccc(Br)n2)(c2cccc(Br)n2)c2ccccc21 |
| InChI | InChI=1S/C24H14Br2N2O/c25-21-13-5-11-19(27-21)24(20-12-6-14-22(26)28-20)17-9-3-1-7-15(17)23(29)16-8-2-4-10-18(16)24/h1-14H |
| InChIKey | CQWGYLHHDMPQOS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.20 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one?
The IUPAC name of 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one (CID 89409704) is 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one.
What is the SMILES notation for 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one?
The canonical SMILES for 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one is O=C1c2ccccc2C(c2cccc(Br)n2)(c2cccc(Br)n2)c2ccccc21.
What is the InChIKey of 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one?
The InChIKey is CQWGYLHHDMPQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14Br2N2O/c25-21-13-5-11-19(27-21)24(20-12-6-14-22(26)28-20)17-9-3-1-7-15(17)23(29)16-8-2-4-10-18(16)24/h1-14H.
What are the key properties of 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one?
10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one has a molecular weight of 506.20 g/mol, XLogP of 5.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one is sourced from PubChem (CID 89409704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).