C24H14Br2N2O — CID 89409704
10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one (PubChem CID 89409704) has the molecular formula C24H14Br2N2O and a molecular weight of 506.20 g/mol. Its IUPAC name is 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one.
| Compound Name | 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one |
|---|---|
| PubChem CID | 89409704 |
| Molecular Formula | C24H14Br2N2O |
| Molecular Weight | 506.20 g/mol |
| Exact Mass | 503.95 |
| IUPAC Name | 10,10-bis(6-bromo-2-pyridinyl)anthracen-9-one |
| SMILES | O=C1c2ccccc2C(c2cccc(Br)n2)(c2cccc(Br)n2)c2ccccc21 |
| InChI | InChI=1S/C24H14Br2N2O/c25-21-13-5-11-19(27-21)24(20-12-6-14-22(26)28-20)17-9-3-1-7-15(17)23(29)16-8-2-4-10-18(16)24/h1-14H |
| InChIKey | CQWGYLHHDMPQOS-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.20 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|