C14H10F2N2 — CID 140723616
2-(2,4-difluoro-3-isocyanophenyl)-4,5-dimethylpyridine (PubChem CID 140723616) has the molecular formula C14H10F2N2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 2-(2,4-difluoro-3-isocyanophenyl)-4,5-dimethylpyridine.
| Compound Name | 2-(2,4-difluoro-3-isocyanophenyl)-4,5-dimethylpyridine |
|---|---|
| PubChem CID | 140723616 |
| Molecular Formula | C14H10F2N2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-(2,4-difluoro-3-isocyanophenyl)-4,5-dimethylpyridine |
| SMILES | [C-]#[N+]c1c(F)ccc(-c2cc(C)c(C)cn2)c1F |
| InChI | InChI=1S/C14H10F2N2/c1-8-6-12(18-7-9(8)2)10-4-5-11(15)14(17-3)13(10)16/h4-7H,1-2H3 |
| InChIKey | MEPKOOAPCMQHRD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|