C17H11F3N2 — CID 168822121
4-methyl-5-pyridin-4-yl-2-(2,4,5-trifluorophenyl)pyridine (PubChem CID 168822121) has the molecular formula C17H11F3N2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 4-methyl-5-pyridin-4-yl-2-(2,4,5-trifluorophenyl)pyridine.
| Compound Name | 4-methyl-5-pyridin-4-yl-2-(2,4,5-trifluorophenyl)pyridine |
|---|---|
| PubChem CID | 168822121 |
| Molecular Formula | C17H11F3N2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-methyl-5-pyridin-4-yl-2-(2,4,5-trifluorophenyl)pyridine |
| SMILES | Cc1cc(-c2cc(F)c(F)cc2F)ncc1-c1ccncc1 |
| InChI | InChI=1S/C17H11F3N2/c1-10-6-17(12-7-15(19)16(20)8-14(12)18)22-9-13(10)11-2-4-21-5-3-11/h2-9H,1H3 |
| InChIKey | JKMNYWZIICTFEE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|