C15H14FN — CID 154660449
4-(7-fluoro-4-methyl-2,3-dihydro-1H-inden-5-yl)pyridine (PubChem CID 154660449) has the molecular formula C15H14FN and a molecular weight of 227.28 g/mol. Its IUPAC name is 4-(7-fluoro-4-methyl-2,3-dihydro-1H-inden-5-yl)pyridine.
| Compound Name | 4-(7-fluoro-4-methyl-2,3-dihydro-1H-inden-5-yl)pyridine |
|---|---|
| PubChem CID | 154660449 |
| Molecular Formula | C15H14FN |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(7-fluoro-4-methyl-2,3-dihydro-1H-inden-5-yl)pyridine |
| SMILES | Cc1c(-c2ccncc2)cc(F)c2c1CCC2 |
| InChI | InChI=1S/C15H14FN/c1-10-12-3-2-4-13(12)15(16)9-14(10)11-5-7-17-8-6-11/h5-9H,2-4H2,1H3 |
| InChIKey | IVGSXLQFUKTNCQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |