C25H22Cl3F3N6S — CID 59646527
7-N-[3-chloro-4-(trifluoromethyl)phenyl]-2-N-(2,6-dichlorophenyl)-5-(2-propan-2-ylpyrrolidin-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine (PubChem CID 59646527) has the molecular formula C25H22Cl3F3N6S and a molecular weight of 601.91 g/mol. Its IUPAC name is 7-N-[3-chloro-4-(trifluoromethyl)phenyl]-2-N-(2,6-dichlorophenyl)-5-(2-propan-2-ylpyrrolidin-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine.
| Compound Name | 7-N-[3-chloro-4-(trifluoromethyl)phenyl]-2-N-(2,6-dichlorophenyl)-5-(2-propan-2-ylpyrrolidin-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 59646527 |
| Molecular Formula | C25H22Cl3F3N6S |
| Molecular Weight | 601.91 g/mol |
| Exact Mass | 600.06 |
| IUPAC Name | 7-N-[3-chloro-4-(trifluoromethyl)phenyl]-2-N-(2,6-dichlorophenyl)-5-(2-propan-2-ylpyrrolidin-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2,7-diamine |
| SMILES | CC(C)C1CCCN1c1nc(Nc2ccc(C(F)(F)F)c(Cl)c2)c2nc(Nc3c(Cl)cccc3Cl)sc2n1 |
| InChI | InChI=1S/C25H22Cl3F3N6S/c1-12(2)18-7-4-10-37(18)23-35-21(32-13-8-9-14(17(28)11-13)25(29,30)31)20-22(36-23)38-24(34-20)33-19-15(26)5-3-6-16(19)27/h3,5-6,8-9,11-12,18H,4,7,10H2,1-2H3,(H,33,34)(H,32,35,36) |
| InChIKey | DSHOAISKGCIZRK-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.91 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |