C33H37F6N5 — CID 59650763
2-[[hexyl(pentyl)amino]methyl]-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine (PubChem CID 59650763) has the molecular formula C33H37F6N5 and a molecular weight of 617.68 g/mol. Its IUPAC name is 2-[[hexyl(pentyl)amino]methyl]-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine.
| Compound Name | 2-[[hexyl(pentyl)amino]methyl]-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 59650763 |
| Molecular Formula | C33H37F6N5 |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | 2-[[hexyl(pentyl)amino]methyl]-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]quinazolin-4-amine |
| SMILES | CCCCCCN(CCCCC)Cc1nc(Nc2ccc(C(F)(F)F)cc2)c2ccc(-c3ncccc3C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C33H37F6N5/c1-3-5-7-9-20-44(19-8-6-4-2)22-29-42-28-21-23(30-27(33(37,38)39)11-10-18-40-30)12-17-26(28)31(43-29)41-25-15-13-24(14-16-25)32(34,35)36/h10-18,21H,3-9,19-20,22H2,1-2H3,(H,41,42,43) |
| InChIKey | HUQFWWNMSHKHMK-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|