C29H36O6 — CID 59651347
1,3-bis[(3,5-diethoxyphenyl)methoxy]-2-methylbenzene (PubChem CID 59651347) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is 1,3-bis[(3,5-diethoxyphenyl)methoxy]-2-methylbenzene.
| Compound Name | 1,3-bis[(3,5-diethoxyphenyl)methoxy]-2-methylbenzene |
|---|---|
| PubChem CID | 59651347 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 1,3-bis[(3,5-diethoxyphenyl)methoxy]-2-methylbenzene |
| SMILES | CCOc1cc(COc2cccc(OCc3cc(OCC)cc(OCC)c3)c2C)cc(OCC)c1 |
| InChI | InChI=1S/C29H36O6/c1-6-30-24-13-22(14-25(17-24)31-7-2)19-34-28-11-10-12-29(21(28)5)35-20-23-15-26(32-8-3)18-27(16-23)33-9-4/h10-18H,6-9,19-20H2,1-5H3 |
| InChIKey | HBUQRXAYXBTCGU-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |