C22H28O2 — CID 59653261
(5S,9R,13R)-16-hydroxy-5,13-dimethylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-1,17,19-trien-8-one (PubChem CID 59653261) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (5S,9R,13R)-16-hydroxy-5,13-dimethylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-1,17,19-trien-8-one.
| Compound Name | (5S,9R,13R)-16-hydroxy-5,13-dimethylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-1,17,19-trien-8-one |
|---|---|
| PubChem CID | 59653261 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (5S,9R,13R)-16-hydroxy-5,13-dimethylpentacyclo[10.8.0.02,9.05,9.013,18]icosa-1,17,19-trien-8-one |
| SMILES | C[C@]12CCC(=O)[C@]13CCC1C(=C3CC2)C=CC2=CC(O)CC[C@@]21C |
| InChI | InChI=1S/C22H28O2/c1-20-9-6-18-16-4-3-14-13-15(23)5-11-21(14,2)17(16)7-12-22(18,20)19(24)8-10-20/h3-4,13,15,17,23H,5-12H2,1-2H3/t15?,17?,20-,21-,22+/m0/s1 |
| InChIKey | MGXSHJPHYRWWRZ-PCBHJHNVSA-N |
| XLogP | 4.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |