C17H24BrN3 — CID 59656014
3-(3-bromo-1-adamantyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 59656014) has the molecular formula C17H24BrN3 and a molecular weight of 350.30 g/mol. Its IUPAC name is 3-(3-bromo-1-adamantyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-(3-bromo-1-adamantyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 59656014 |
| Molecular Formula | C17H24BrN3 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 3-(3-bromo-1-adamantyl)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | BrC12CC3CC(C1)CC(c1nnc4n1CCCCC4)(C3)C2 |
| InChI | InChI=1S/C17H24BrN3/c18-17-9-12-6-13(10-17)8-16(7-12,11-17)15-20-19-14-4-2-1-3-5-21(14)15/h12-13H,1-11H2 |
| InChIKey | GPEUQXCVHXUFAT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|