C20H25F3N4S — CID 11246867
2-[4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)-1-bicyclo[2.2.2]octanyl]-5-(trifluoromethyl)-1,3-thiazole (PubChem CID 11246867) has the molecular formula C20H25F3N4S and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)-1-bicyclo[2.2.2]octanyl]-5-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 2-[4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)-1-bicyclo[2.2.2]octanyl]-5-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 11246867 |
| Molecular Formula | C20H25F3N4S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[4-(5,6,7,8,9,10-hexahydro-[1,2,4]triazolo[4,3-a]azocin-3-yl)-1-bicyclo[2.2.2]octanyl]-5-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1cnc(C23CCC(c4nnc5n4CCCCCC5)(CC2)CC3)s1 |
| InChI | InChI=1S/C20H25F3N4S/c21-20(22,23)14-13-24-17(28-14)19-9-6-18(7-10-19,8-11-19)16-26-25-15-5-3-1-2-4-12-27(15)16/h13H,1-12H2 |
| InChIKey | LCPZCKADKLPCPE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |