C21H36O6 — CID 59659634
5-[4,8-dihydroxy-11-(6-oxooxan-3-yl)undecyl]oxan-2-one (PubChem CID 59659634) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 5-[4,8-dihydroxy-11-(6-oxooxan-3-yl)undecyl]oxan-2-one.
| Compound Name | 5-[4,8-dihydroxy-11-(6-oxooxan-3-yl)undecyl]oxan-2-one |
|---|---|
| PubChem CID | 59659634 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 5-[4,8-dihydroxy-11-(6-oxooxan-3-yl)undecyl]oxan-2-one |
| SMILES | O=C1CCC(CCCC(O)CCCC(O)CCCC2CCC(=O)OC2)CO1 |
| InChI | InChI=1S/C21H36O6/c22-18(6-1-4-16-10-12-20(24)26-14-16)8-3-9-19(23)7-2-5-17-11-13-21(25)27-15-17/h16-19,22-23H,1-15H2 |
| InChIKey | CDHWMLXXACIYML-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |