C62H82N2O4 — CID 59660969
6-(dimethylamino)-2-[2-[5-methyl-2-[(7-methyl-9,9-dioctylfluoren-2-yl)methyl]-4-octoxyphenoxy]ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 59660969) has the molecular formula C62H82N2O4 and a molecular weight of 919.35 g/mol. Its IUPAC name is 6-(dimethylamino)-2-[2-[5-methyl-2-[(7-methyl-9,9-dioctylfluoren-2-yl)methyl]-4-octoxyphenoxy]ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(dimethylamino)-2-[2-[5-methyl-2-[(7-methyl-9,9-dioctylfluoren-2-yl)methyl]-4-octoxyphenoxy]ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 59660969 |
| Molecular Formula | C62H82N2O4 |
| Molecular Weight | 919.35 g/mol |
| Exact Mass | 918.63 |
| IUPAC Name | 6-(dimethylamino)-2-[2-[5-methyl-2-[(7-methyl-9,9-dioctylfluoren-2-yl)methyl]-4-octoxyphenoxy]ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCCCCCOc1cc(Cc2ccc3c(c2)C(CCCCCCCC)(CCCCCCCC)c2cc(C)ccc2-3)c(OCCN2C(=O)c3cccc4c(N(C)C)ccc(c34)C2=O)cc1C |
| InChI | InChI=1S/C62H82N2O4/c1-8-11-14-17-20-23-35-62(36-24-21-18-15-12-9-2)54-40-45(4)29-31-49(54)50-32-30-47(43-55(50)62)42-48-44-57(67-38-25-22-19-16-13-10-3)46(5)41-58(48)68-39-37-64-60(65)52-28-26-27-51-56(63(6)7)34-33-53(59(51)52)61(64)66/h26-34,40-41,43-44H,8-25,35-39,42H2,1-7H3 |
| InChIKey | YVOXKJCERHBWPA-UHFFFAOYSA-N |
| XLogP | 16.30 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.35 |
| LogP ≤ 5 | 16.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|