C32H32N2O4 — CID 11145629
2,8-dimethoxy-5-[4-(2-piperidin-1-ylethoxy)phenyl]benzo[c]phenanthridin-6-one (PubChem CID 11145629) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 2,8-dimethoxy-5-[4-(2-piperidin-1-ylethoxy)phenyl]benzo[c]phenanthridin-6-one.
| Compound Name | 2,8-dimethoxy-5-[4-(2-piperidin-1-ylethoxy)phenyl]benzo[c]phenanthridin-6-one |
|---|---|
| PubChem CID | 11145629 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2,8-dimethoxy-5-[4-(2-piperidin-1-ylethoxy)phenyl]benzo[c]phenanthridin-6-one |
| SMILES | COc1ccc2c(ccc3c4ccc(OC)cc4c(=O)n(-c4ccc(OCCN5CCCCC5)cc4)c23)c1 |
| InChI | InChI=1S/C32H32N2O4/c1-36-25-11-14-27-22(20-25)6-13-29-28-15-12-26(37-2)21-30(28)32(35)34(31(27)29)23-7-9-24(10-8-23)38-19-18-33-16-4-3-5-17-33/h6-15,20-21H,3-5,16-19H2,1-2H3 |
| InChIKey | RUZSFBLIXUTCTP-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|