C27H17F3N4Pt — CID 59660981
N-phenyl-N-(1-phenylpyrazol-3-yl)-6-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridin-2-amine;platinum(2+) (PubChem CID 59660981) has the molecular formula C27H17F3N4Pt and a molecular weight of 649.53 g/mol. Its IUPAC name is N-phenyl-N-(1-phenylpyrazol-3-yl)-6-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridin-2-amine;platinum(2+).
| Compound Name | N-phenyl-N-(1-phenylpyrazol-3-yl)-6-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridin-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 59660981 |
| Molecular Formula | C27H17F3N4Pt |
| Molecular Weight | 649.53 g/mol |
| Exact Mass | 649.11 |
| IUPAC Name | N-phenyl-N-(1-phenylpyrazol-3-yl)-6-[3-(trifluoromethyl)benzene-6-id-1-yl]pyridin-2-amine;platinum(2+) |
| SMILES | FC(F)(F)c1cc[c-]c(-c2cccc(N(c3ccccc3)c3ccn(-c4[c-]cccc4)n3)n2)c1.[Pt+2] |
| InChI | InChI=1S/C27H17F3N4.Pt/c28-27(29,30)21-10-7-9-20(19-21)24-15-8-16-25(31-24)34(23-13-5-2-6-14-23)26-17-18-33(32-26)22-11-3-1-4-12-22;/h1-8,10-11,13-19H;/q-2;+2 |
| InChIKey | WSMXDUPPMLPJFA-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.53 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|