C23H15N4OPt- — CID 59661178
3-[(6-phenyl-2-pyridinyl)oxy]-1-pyridin-2-ylindazole;platinum (PubChem CID 59661178) has the molecular formula C23H15N4OPt- and a molecular weight of 558.48 g/mol. Its IUPAC name is 3-[(6-phenyl-2-pyridinyl)oxy]-1-pyridin-2-ylindazole;platinum.
| Compound Name | 3-[(6-phenyl-2-pyridinyl)oxy]-1-pyridin-2-ylindazole;platinum |
|---|---|
| PubChem CID | 59661178 |
| Molecular Formula | C23H15N4OPt- |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | 3-[(6-phenyl-2-pyridinyl)oxy]-1-pyridin-2-ylindazole;platinum |
| SMILES | [Pt].[c-]1ccccc1-c1cccc(Oc2nn(-c3ccccn3)c3ccccc23)n1 |
| InChI | InChI=1S/C23H15N4O.Pt/c1-2-9-17(10-3-1)19-12-8-15-22(25-19)28-23-18-11-4-5-13-20(18)27(26-23)21-14-6-7-16-24-21;/h1-9,11-16H;/q-1; |
| InChIKey | RTYAXZITWBWLCO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|