C36H39N5 — CID 59661233
5-cyclohexyl-N-(5-cyclohexyl-1-phenylpyrazol-3-yl)-N,1-diphenylpyrazol-3-amine (PubChem CID 59661233) has the molecular formula C36H39N5 and a molecular weight of 541.74 g/mol. Its IUPAC name is 5-cyclohexyl-N-(5-cyclohexyl-1-phenylpyrazol-3-yl)-N,1-diphenylpyrazol-3-amine.
| Compound Name | 5-cyclohexyl-N-(5-cyclohexyl-1-phenylpyrazol-3-yl)-N,1-diphenylpyrazol-3-amine |
|---|---|
| PubChem CID | 59661233 |
| Molecular Formula | C36H39N5 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | 5-cyclohexyl-N-(5-cyclohexyl-1-phenylpyrazol-3-yl)-N,1-diphenylpyrazol-3-amine |
| SMILES | c1ccc(N(c2cc(C3CCCCC3)n(-c3ccccc3)n2)c2cc(C3CCCCC3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C36H39N5/c1-6-16-28(17-7-1)33-26-35(37-40(33)31-22-12-4-13-23-31)39(30-20-10-3-11-21-30)36-27-34(29-18-8-2-9-19-29)41(38-36)32-24-14-5-15-25-32/h3-5,10-15,20-29H,1-2,6-9,16-19H2 |
| InChIKey | MDURTYJIOAKQKM-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |