C15H20N2 — CID 20532038
2-cyclohexyl-1-phenyl-4,5-dihydroimidazole (PubChem CID 20532038) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-cyclohexyl-1-phenyl-4,5-dihydroimidazole.
| Compound Name | 2-cyclohexyl-1-phenyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 20532038 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-cyclohexyl-1-phenyl-4,5-dihydroimidazole |
| SMILES | c1ccc(N2CCN=C2C2CCCCC2)cc1 |
| InChI | InChI=1S/C15H20N2/c1-3-7-13(8-4-1)15-16-11-12-17(15)14-9-5-2-6-10-14/h2,5-6,9-10,13H,1,3-4,7-8,11-12H2 |
| InChIKey | PIPIHMRPTUCSRN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |