C16H19N — CID 176907812
6-methyl-1-phenyl-3,4,4a,5-tetrahydro-2H-quinoline (PubChem CID 176907812) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 6-methyl-1-phenyl-3,4,4a,5-tetrahydro-2H-quinoline.
| Compound Name | 6-methyl-1-phenyl-3,4,4a,5-tetrahydro-2H-quinoline |
|---|---|
| PubChem CID | 176907812 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 6-methyl-1-phenyl-3,4,4a,5-tetrahydro-2H-quinoline |
| SMILES | CC1=CC=C2C(CCCN2c2ccccc2)C1 |
| InChI | InChI=1S/C16H19N/c1-13-9-10-16-14(12-13)6-5-11-17(16)15-7-3-2-4-8-15/h2-4,7-10,14H,5-6,11-12H2,1H3 |
| InChIKey | PZOWLCXBZIQVPB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |