C16H19NO2SSe — CID 163360895
1-methylsulfonyl-6-phenylselanyl-3,4,4a,5-tetrahydro-2H-quinoline (PubChem CID 163360895) has the molecular formula C16H19NO2SSe and a molecular weight of 368.36 g/mol. Its IUPAC name is 1-methylsulfonyl-6-phenylselanyl-3,4,4a,5-tetrahydro-2H-quinoline.
| Compound Name | 1-methylsulfonyl-6-phenylselanyl-3,4,4a,5-tetrahydro-2H-quinoline |
|---|---|
| PubChem CID | 163360895 |
| Molecular Formula | C16H19NO2SSe |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 1-methylsulfonyl-6-phenylselanyl-3,4,4a,5-tetrahydro-2H-quinoline |
| SMILES | CS(=O)(=O)N1CCCC2CC([Se]c3ccccc3)=CC=C21 |
| InChI | InChI=1S/C16H19NO2SSe/c1-20(18,19)17-11-5-6-13-12-15(9-10-16(13)17)21-14-7-3-2-4-8-14/h2-4,7-10,13H,5-6,11-12H2,1H3 |
| InChIKey | XYTLZASGYBKCPI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|