C27H41N6O6Y- — CID 59661290
CID 59661290 (PubChem CID 59661290) has the molecular formula C27H41N6O6Y- and a molecular weight of 634.57 g/mol.
| Compound Name | CID 59661290 |
|---|---|
| PubChem CID | 59661290 |
| Molecular Formula | C27H41N6O6Y- |
| Molecular Weight | 634.57 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | — |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](n2nn[c-]c2C)CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)OCC.[Y] |
| InChI | InChI=1S/C27H41N6O6.Y/c1-10-17-13-27(17,23(36)38-11-2)30-21(34)19-12-18(33-16(3)14-28-31-33)15-32(19)22(35)20(25(4,5)6)29-24(37)39-26(7,8)9;/h10,17-20H,1,11-13,15H2,2-9H3,(H,29,37)(H,30,34);/q-1;/t17-,18-,19+,20-,27-;/m1./s1 |
| InChIKey | GIFKEYVPQRNWME-MMNOMMKSSA-N |
| XLogP | 2.09 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|