C32H43N6O6Y- — CID 59661294
CID 59661294 (PubChem CID 59661294) has the molecular formula C32H43N6O6Y- and a molecular weight of 696.64 g/mol.
| Compound Name | CID 59661294 |
|---|---|
| PubChem CID | 59661294 |
| Molecular Formula | C32H43N6O6Y- |
| Molecular Weight | 696.64 g/mol |
| Exact Mass | 696.23 |
| IUPAC Name | — |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](n2n[c-]c(-c3ccccc3)n2)CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)OCC.[Y] |
| InChI | InChI=1S/C32H43N6O6.Y/c1-9-21-17-32(21,28(41)43-10-2)35-26(39)24-16-22(38-33-18-23(36-38)20-14-12-11-13-15-20)19-37(24)27(40)25(30(3,4)5)34-29(42)44-31(6,7)8;/h9,11-15,21-22,24-25H,1,10,16-17,19H2,2-8H3,(H,34,42)(H,35,39);/q-1;/t21-,22-,24+,25-,32-;/m1./s1 |
| InChIKey | SIRWZLZTXYPSKH-QEXOOOQBSA-N |
| XLogP | 3.45 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|