C34H28IrN5 — CID 59661521
3a,4,5,9-tetrahydrobenzo[g]indol-9-ide;bis(6,10-dihydro-5H-imidazo[2,1-a]isoquinolin-10-ide);iridium(3+) (PubChem CID 59661521) has the molecular formula C34H28IrN5 and a molecular weight of 698.85 g/mol. Its IUPAC name is 3a,4,5,9-tetrahydrobenzo[g]indol-9-ide;bis(6,10-dihydro-5H-imidazo[2,1-a]isoquinolin-10-ide);iridium(3+).
| Compound Name | 3a,4,5,9-tetrahydrobenzo[g]indol-9-ide;bis(6,10-dihydro-5H-imidazo[2,1-a]isoquinolin-10-ide);iridium(3+) |
|---|---|
| PubChem CID | 59661521 |
| Molecular Formula | C34H28IrN5 |
| Molecular Weight | 698.85 g/mol |
| Exact Mass | 699.20 |
| IUPAC Name | 3a,4,5,9-tetrahydrobenzo[g]indol-9-ide;bis(6,10-dihydro-5H-imidazo[2,1-a]isoquinolin-10-ide);iridium(3+) |
| SMILES | [Ir+3].[c-]1cccc2c1-c1nccn1CC2.[c-]1cccc2c1-c1nccn1CC2.[c-]1cccc2c1C1=NC=CC1CC2 |
| InChI | InChI=1S/C12H10N.2C11H9N2.Ir/c1-2-4-11-9(3-1)5-6-10-7-8-13-12(10)11;2*1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;/h1-3,7-8,10H,5-6H2;2*1-3,6,8H,5,7H2;/q3*-1;+3 |
| InChIKey | RHGNMSQHJSDKPU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.85 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|