About 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum
3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum (PubChem CID 59661624) has the molecular formula C9H8N3Pt-
and a molecular weight of 353.26 g/mol. Its IUPAC name is 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum.
Molecular Properties
| Compound Name | 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum |
| PubChem CID | 59661624 |
| Molecular Formula | C9H8N3Pt- |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum |
| SMILES | Cn1ccc(-c2[c-]ccnc2)n1.[Pt] |
| InChI | InChI=1S/C9H8N3.Pt/c1-12-6-4-9(11-12)8-3-2-5-10-7-8;/h2,4-7H,1H3;/q-1; |
| InChIKey | AVDBXIBSZAHIKP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum?
The IUPAC name of 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum (CID 59661624) is 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum.
What is the SMILES notation for 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum?
The canonical SMILES for 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum is Cn1ccc(-c2[c-]ccnc2)n1.[Pt].
What is the InChIKey of 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum?
The InChIKey is AVDBXIBSZAHIKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N3.Pt/c1-12-6-4-9(11-12)8-3-2-5-10-7-8;/h2,4-7H,1H3;/q-1;.
What are the key properties of 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum?
3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum has a molecular weight of 353.26 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methylpyrazol-3-yl)-4H-pyridin-4-ide;platinum is sourced from PubChem (CID 59661624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).