About iridium;1-phenyltetrazole
iridium;1-phenyltetrazole (PubChem CID 59661672) has the molecular formula C7H5IrN4-
and a molecular weight of 337.36 g/mol. Its IUPAC name is iridium;1-phenyltetrazole.
Molecular Properties
| Compound Name | iridium;1-phenyltetrazole |
| PubChem CID | 59661672 |
| Molecular Formula | C7H5IrN4- |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | iridium;1-phenyltetrazole |
| SMILES | [Ir].[c-]1ccccc1-n1cnnn1 |
| InChI | InChI=1S/C7H5N4.Ir/c1-2-4-7(5-3-1)11-6-8-9-10-11;/h1-4,6H;/q-1; |
| InChIKey | OINUJUCNIFCFKH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-phenyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-phenyltetrazole?
The IUPAC name of iridium;1-phenyltetrazole (CID 59661672) is iridium;1-phenyltetrazole.
What is the SMILES notation for iridium;1-phenyltetrazole?
The canonical SMILES for iridium;1-phenyltetrazole is [Ir].[c-]1ccccc1-n1cnnn1.
What is the InChIKey of iridium;1-phenyltetrazole?
The InChIKey is OINUJUCNIFCFKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N4.Ir/c1-2-4-7(5-3-1)11-6-8-9-10-11;/h1-4,6H;/q-1;.
What are the key properties of iridium;1-phenyltetrazole?
iridium;1-phenyltetrazole has a molecular weight of 337.36 g/mol, XLogP of 0.46, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-phenyltetrazole is sourced from PubChem (CID 59661672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).