About iridium;1-phenyl-1,2,4-triazole
iridium;1-phenyl-1,2,4-triazole (PubChem CID 23526310) has the molecular formula C8H6IrN3-
and a molecular weight of 336.37 g/mol. Its IUPAC name is iridium;1-phenyl-1,2,4-triazole.
Molecular Properties
| Compound Name | iridium;1-phenyl-1,2,4-triazole |
| PubChem CID | 23526310 |
| Molecular Formula | C8H6IrN3- |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | iridium;1-phenyl-1,2,4-triazole |
| SMILES | [Ir].[c-]1ccccc1-n1cncn1 |
| InChI | InChI=1S/C8H6N3.Ir/c1-2-4-8(5-3-1)11-7-9-6-10-11;/h1-4,6-7H;/q-1; |
| InChIKey | QGYSDDNEJUDITB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-phenyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-phenyl-1,2,4-triazole?
The IUPAC name of iridium;1-phenyl-1,2,4-triazole (CID 23526310) is iridium;1-phenyl-1,2,4-triazole.
What is the SMILES notation for iridium;1-phenyl-1,2,4-triazole?
The canonical SMILES for iridium;1-phenyl-1,2,4-triazole is [Ir].[c-]1ccccc1-n1cncn1.
What is the InChIKey of iridium;1-phenyl-1,2,4-triazole?
The InChIKey is QGYSDDNEJUDITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N3.Ir/c1-2-4-8(5-3-1)11-7-9-6-10-11;/h1-4,6-7H;/q-1;.
What are the key properties of iridium;1-phenyl-1,2,4-triazole?
iridium;1-phenyl-1,2,4-triazole has a molecular weight of 336.37 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-phenyl-1,2,4-triazole is sourced from PubChem (CID 23526310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).