C9H9IrN3 — CID 153088729
iridium;4-methyl-1-phenyl-1,2,4-triazol-4-ium (PubChem CID 153088729) has the molecular formula C9H9IrN3 and a molecular weight of 351.41 g/mol. Its IUPAC name is iridium;4-methyl-1-phenyl-1,2,4-triazol-4-ium.
| Compound Name | iridium;4-methyl-1-phenyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 153088729 |
| Molecular Formula | C9H9IrN3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | iridium;4-methyl-1-phenyl-1,2,4-triazol-4-ium |
| SMILES | C[n+]1cnn(-c2[c-]cccc2)c1.[Ir] |
| InChI | InChI=1S/C9H9N3.Ir/c1-11-7-10-12(8-11)9-5-3-2-4-6-9;/h2-5,7-8H,1H3; |
| InChIKey | VOSMKELXHFREIC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|