C13H18N6+2 — CID 123732539
1-[1-ethenyl-3-(4-methyl-1,2,4-triazol-4-ium-1-yl)penta-1,3-dienyl]-4-methyl-1,2,4-triazol-4-ium (PubChem CID 123732539) has the molecular formula C13H18N6+2 and a molecular weight of 258.33 g/mol. Its IUPAC name is 1-[1-ethenyl-3-(4-methyl-1,2,4-triazol-4-ium-1-yl)penta-1,3-dienyl]-4-methyl-1,2,4-triazol-4-ium.
| Compound Name | 1-[1-ethenyl-3-(4-methyl-1,2,4-triazol-4-ium-1-yl)penta-1,3-dienyl]-4-methyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 123732539 |
| Molecular Formula | C13H18N6+2 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-[1-ethenyl-3-(4-methyl-1,2,4-triazol-4-ium-1-yl)penta-1,3-dienyl]-4-methyl-1,2,4-triazol-4-ium |
| SMILES | C=CC(=CC(=CC)n1c[n+](C)cn1)n1c[n+](C)cn1 |
| InChI | InChI=1S/C13H18N6/c1-5-12(18-10-16(3)8-14-18)7-13(6-2)19-11-17(4)9-15-19/h5-11H,1H2,2-4H3/q+2 |
| InChIKey | PYTNNSIFYHIQQB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|