C11H16N6+2 — CID 11143668
4-prop-2-enyl-1-[(4-prop-2-enyl-1,2,4-triazol-4-ium-1-yl)methyl]-1,2,4-triazol-4-ium (PubChem CID 11143668) has the molecular formula C11H16N6+2 and a molecular weight of 232.29 g/mol. Its IUPAC name is 4-prop-2-enyl-1-[(4-prop-2-enyl-1,2,4-triazol-4-ium-1-yl)methyl]-1,2,4-triazol-4-ium.
| Compound Name | 4-prop-2-enyl-1-[(4-prop-2-enyl-1,2,4-triazol-4-ium-1-yl)methyl]-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 11143668 |
| Molecular Formula | C11H16N6+2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 4-prop-2-enyl-1-[(4-prop-2-enyl-1,2,4-triazol-4-ium-1-yl)methyl]-1,2,4-triazol-4-ium |
| SMILES | C=CC[n+]1cnn(Cn2c[n+](CC=C)cn2)c1 |
| InChI | InChI=1S/C11H16N6/c1-3-5-14-7-12-16(9-14)11-17-10-15(6-4-2)8-13-17/h3-4,7-10H,1-2,5-6,11H2/q+2 |
| InChIKey | ONWVJYPJDKGGPV-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|