C13H24N6+2 — CID 15876261
4-butyl-1-[(4-butyl-1,2,4-triazol-4-ium-1-yl)methyl]-1,2,4-triazol-4-ium (PubChem CID 15876261) has the molecular formula C13H24N6+2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 4-butyl-1-[(4-butyl-1,2,4-triazol-4-ium-1-yl)methyl]-1,2,4-triazol-4-ium.
| Compound Name | 4-butyl-1-[(4-butyl-1,2,4-triazol-4-ium-1-yl)methyl]-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 15876261 |
| Molecular Formula | C13H24N6+2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 4-butyl-1-[(4-butyl-1,2,4-triazol-4-ium-1-yl)methyl]-1,2,4-triazol-4-ium |
| SMILES | CCCC[n+]1cnn(Cn2c[n+](CCCC)cn2)c1 |
| InChI | InChI=1S/C13H24N6/c1-3-5-7-16-9-14-18(11-16)13-19-12-17(10-15-19)8-6-4-2/h9-12H,3-8,13H2,1-2H3/q+2 |
| InChIKey | NRDZMKGYXGJDGY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|