C9H12N6 — CID 13133628
1-[(E)-2-methyl-4-(1,2,4-triazol-1-yl)but-2-enyl]-1,2,4-triazole (PubChem CID 13133628) has the molecular formula C9H12N6 and a molecular weight of 204.24 g/mol. Its IUPAC name is 1-[(E)-2-methyl-4-(1,2,4-triazol-1-yl)but-2-enyl]-1,2,4-triazole.
| Compound Name | 1-[(E)-2-methyl-4-(1,2,4-triazol-1-yl)but-2-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 13133628 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 1-[(E)-2-methyl-4-(1,2,4-triazol-1-yl)but-2-enyl]-1,2,4-triazole |
| SMILES | C/C(=C\Cn1cncn1)Cn1cncn1 |
| InChI | InChI=1S/C9H12N6/c1-9(4-15-8-11-6-13-15)2-3-14-7-10-5-12-14/h2,5-8H,3-4H2,1H3/b9-2+ |
| InChIKey | BQRJEQICVJYAGG-XNWCZRBMSA-N |
| XLogP | 0.52 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|