C8H10N6 — CID 13295575
1-[2-(1,2,4-triazol-1-ylmethyl)prop-2-enyl]-1,2,4-triazole (PubChem CID 13295575) has the molecular formula C8H10N6 and a molecular weight of 190.21 g/mol. Its IUPAC name is 1-[2-(1,2,4-triazol-1-ylmethyl)prop-2-enyl]-1,2,4-triazole.
| Compound Name | 1-[2-(1,2,4-triazol-1-ylmethyl)prop-2-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 13295575 |
| Molecular Formula | C8H10N6 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1-[2-(1,2,4-triazol-1-ylmethyl)prop-2-enyl]-1,2,4-triazole |
| SMILES | C=C(Cn1cncn1)Cn1cncn1 |
| InChI | InChI=1S/C8H10N6/c1-8(2-13-6-9-4-11-13)3-14-7-10-5-12-14/h4-7H,1-3H2 |
| InChIKey | ILIKOIQXLQJAJN-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|