C8H14N4 — CID 130615032
N,4-dimethyl-N-(2-methylprop-2-enyl)-1,2,4-triazol-3-amine (PubChem CID 130615032) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is N,4-dimethyl-N-(2-methylprop-2-enyl)-1,2,4-triazol-3-amine.
| Compound Name | N,4-dimethyl-N-(2-methylprop-2-enyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 130615032 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | N,4-dimethyl-N-(2-methylprop-2-enyl)-1,2,4-triazol-3-amine |
| SMILES | C=C(C)CN(C)c1nncn1C |
| InChI | InChI=1S/C8H14N4/c1-7(2)5-11(3)8-10-9-6-12(8)4/h6H,1,5H2,2-4H3 |
| InChIKey | CWQIGKYNRHPLGH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|