C14H23N3 — CID 145001229
ethane;4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-1,2,4-triazole (PubChem CID 145001229) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is ethane;4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-1,2,4-triazole.
| Compound Name | ethane;4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 145001229 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | ethane;4-[(3E,5Z)-octa-1,3,5,7-tetraen-3-yl]-1,2,4-triazole |
| SMILES | C=C/C=C\C=C(/C=C)n1cnnc1.CC.CC |
| InChI | InChI=1S/C10H11N3.2C2H6/c1-3-5-6-7-10(4-2)13-8-11-12-9-13;2*1-2/h3-9H,1-2H2;2*1-2H3/b6-5-,10-7+;; |
| InChIKey | LXBKCGMUURWKFJ-FANFBDPASA-N |
| XLogP | 4.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|