C8H9ClN4 — CID 88948708
(1E,3Z)-5-chloro-2-(1,2,4-triazol-4-yl)hexa-1,3,5-trien-1-amine (PubChem CID 88948708) has the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. Its IUPAC name is (1E,3Z)-5-chloro-2-(1,2,4-triazol-4-yl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-5-chloro-2-(1,2,4-triazol-4-yl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88948708 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (1E,3Z)-5-chloro-2-(1,2,4-triazol-4-yl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C(Cl)/C=C\C(=C/N)n1cnnc1 |
| InChI | InChI=1S/C8H9ClN4/c1-7(9)2-3-8(4-10)13-5-11-12-6-13/h2-6H,1,10H2/b3-2-,8-4+ |
| InChIKey | OUTZGJCTSBPKIN-SOBRUKQLSA-N |
| XLogP | 1.34 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|