C16H18NPt- — CID 59661682
5-tert-butyl-2-cyclohepta-1,3,5-trien-1-ylpyridine;platinum (PubChem CID 59661682) has the molecular formula C16H18NPt- and a molecular weight of 419.41 g/mol. Its IUPAC name is 5-tert-butyl-2-cyclohepta-1,3,5-trien-1-ylpyridine;platinum.
| Compound Name | 5-tert-butyl-2-cyclohepta-1,3,5-trien-1-ylpyridine;platinum |
|---|---|
| PubChem CID | 59661682 |
| Molecular Formula | C16H18NPt- |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 5-tert-butyl-2-cyclohepta-1,3,5-trien-1-ylpyridine;platinum |
| SMILES | CC(C)(C)c1ccc(C2=[C-]C=CC=CC2)nc1.[Pt] |
| InChI | InChI=1S/C16H18N.Pt/c1-16(2,3)14-10-11-15(17-12-14)13-8-6-4-5-7-9-13;/h4-7,10-12H,8H2,1-3H3;/q-1; |
| InChIKey | GQBAVKRHMFEMFY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|