C27H38IrNO2- — CID 59661593
5-tert-butyl-2-cyclohepta-1,3,5-trien-1-ylpyridine;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium (PubChem CID 59661593) has the molecular formula C27H38IrNO2- and a molecular weight of 600.82 g/mol. Its IUPAC name is 5-tert-butyl-2-cyclohepta-1,3,5-trien-1-ylpyridine;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium.
| Compound Name | 5-tert-butyl-2-cyclohepta-1,3,5-trien-1-ylpyridine;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 59661593 |
| Molecular Formula | C27H38IrNO2- |
| Molecular Weight | 600.82 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 5-tert-butyl-2-cyclohepta-1,3,5-trien-1-ylpyridine;(Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;iridium |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.CC(C)(C)c1ccc(C2=[C-]C=CC=CC2)nc1.[Ir] |
| InChI | InChI=1S/C16H18N.C11H20O2.Ir/c1-16(2,3)14-10-11-15(17-12-14)13-8-6-4-5-7-9-13;1-10(2,3)8(12)7-9(13)11(4,5)6;/h4-7,10-12H,8H2,1-3H3;7,12H,1-6H3;/q-1;;/b;8-7-; |
| InChIKey | MECRBLFCPJSQCA-HXIBTQJOSA-N |
| XLogP | 7.17 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.82 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|