1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride

C14H22Cl3N3O3 — CID 59661795

IUPAC1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride
SMILESO=C(Cl)N1CCCCCCN(C(=O)Cl)CCN(C(=O)Cl)CCC1
InChIInChI=1S/C14H22Cl3N3O3/c15-12(21)18-6-3-1-2-4-7-19(13(16)22)10-11-20(14(17)23)9-5-8-18/h1-11H2
InChIKeyJSXGXYTXBUQWEJ-UHFFFAOYSA-N
MW386.71 g/mol
LogP3.93
Rot. Bonds

About 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride

1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride (PubChem CID 59661795) has the molecular formula C14H22Cl3N3O3 and a molecular weight of 386.71 g/mol. Its IUPAC name is 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride.

Molecular Properties

Compound Name1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride
PubChem CID59661795
Molecular FormulaC14H22Cl3N3O3
Molecular Weight386.71 g/mol
Exact Mass385.07
IUPAC Name1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride
SMILESO=C(Cl)N1CCCCCCN(C(=O)Cl)CCN(C(=O)Cl)CCC1
InChIInChI=1S/C14H22Cl3N3O3/c15-12(21)18-6-3-1-2-4-7-19(13(16)22)10-11-20(14(17)23)9-5-8-18/h1-11H2
InChIKeyJSXGXYTXBUQWEJ-UHFFFAOYSA-N
XLogP3.93
TPSA60.93 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500386.71
LogP ≤ 53.93
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride?
The IUPAC name of 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride (CID 59661795) is 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride.
What is the SMILES notation for 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride?
The canonical SMILES for 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride is O=C(Cl)N1CCCCCCN(C(=O)Cl)CCN(C(=O)Cl)CCC1.
What is the InChIKey of 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride?
The InChIKey is JSXGXYTXBUQWEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22Cl3N3O3/c15-12(21)18-6-3-1-2-4-7-19(13(16)22)10-11-20(14(17)23)9-5-8-18/h1-11H2.
What are the key properties of 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride?
1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride has a molecular weight of 386.71 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,8-triazacyclotetradecane-1,4,8-tricarbonyl chloride is sourced from PubChem (CID 59661795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).