About 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium
5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium (PubChem CID 59663086) has the molecular formula C8H9NY-2
and a molecular weight of 208.07 g/mol. Its IUPAC name is 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium.
Molecular Properties
| Compound Name | 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium |
| PubChem CID | 59663086 |
| Molecular Formula | C8H9NY-2 |
| Molecular Weight | 208.07 g/mol |
| Exact Mass | 207.98 |
| IUPAC Name | 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium |
| SMILES | [H]/[C-]=C/C1=[C-]CCN=C1C.[Y] |
| InChI | InChI=1S/C8H9N.Y/c1-3-8-5-4-6-9-7(8)2;/h1,3H,4,6H2,2H3;/q-2; |
| InChIKey | LLTFVZWIKYJWDW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.07 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium?
The IUPAC name of 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium (CID 59663086) is 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium.
What is the SMILES notation for 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium?
The canonical SMILES for 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium is [H]/[C-]=C/C1=[C-]CCN=C1C.[Y].
What is the InChIKey of 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium?
The InChIKey is LLTFVZWIKYJWDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.Y/c1-3-8-5-4-6-9-7(8)2;/h1,3H,4,6H2,2H3;/q-2;.
What are the key properties of 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium?
5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium has a molecular weight of 208.07 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-6-methyl-3,4-dihydro-2H-pyridin-4-ide;yttrium is sourced from PubChem (CID 59663086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).