C36H34N4O5S — CID 59664878
3-cyclohexyl-17-(2,4-dimethyl-1,3-thiazol-5-yl)-11-(morpholine-4-carbonyl)-12-oxo-10,16-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4(9),5,7,14,16,18,20-nonaene-7-carboxylic acid (PubChem CID 59664878) has the molecular formula C36H34N4O5S and a molecular weight of 634.76 g/mol. Its IUPAC name is 3-cyclohexyl-17-(2,4-dimethyl-1,3-thiazol-5-yl)-11-(morpholine-4-carbonyl)-12-oxo-10,16-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4(9),5,7,14,16,18,20-nonaene-7-carboxylic acid.
| Compound Name | 3-cyclohexyl-17-(2,4-dimethyl-1,3-thiazol-5-yl)-11-(morpholine-4-carbonyl)-12-oxo-10,16-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4(9),5,7,14,16,18,20-nonaene-7-carboxylic acid |
|---|---|
| PubChem CID | 59664878 |
| Molecular Formula | C36H34N4O5S |
| Molecular Weight | 634.76 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | 3-cyclohexyl-17-(2,4-dimethyl-1,3-thiazol-5-yl)-11-(morpholine-4-carbonyl)-12-oxo-10,16-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(13),2,4(9),5,7,14,16,18,20-nonaene-7-carboxylic acid |
| SMILES | Cc1nc(C)c(-c2ccc3cc4c(cc3n2)C(=O)C(C(=O)N2CCOCC2)n2c-4c(C3CCCCC3)c3ccc(C(=O)O)cc32)s1 |
| InChI | InChI=1S/C36H34N4O5S/c1-19-34(46-20(2)37-19)27-11-9-22-16-25-26(18-28(22)38-27)33(41)32(35(42)39-12-14-45-15-13-39)40-29-17-23(36(43)44)8-10-24(29)30(31(25)40)21-6-4-3-5-7-21/h8-11,16-18,21,32H,3-7,12-15H2,1-2H3,(H,43,44) |
| InChIKey | GEJVGYMXFAORQU-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.76 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|