C32H39N3O4S — CID 59666133
[(3S,4R)-1-(4-tert-butylphenyl)sulfonyl-4-phenylpyrrolidin-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 59666133) has the molecular formula C32H39N3O4S and a molecular weight of 561.75 g/mol. Its IUPAC name is [(3S,4R)-1-(4-tert-butylphenyl)sulfonyl-4-phenylpyrrolidin-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [(3S,4R)-1-(4-tert-butylphenyl)sulfonyl-4-phenylpyrrolidin-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 59666133 |
| Molecular Formula | C32H39N3O4S |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | [(3S,4R)-1-(4-tert-butylphenyl)sulfonyl-4-phenylpyrrolidin-3-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)[C@@H]3CN(S(=O)(=O)c4ccc(C(C)(C)C)cc4)C[C@H]3c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H39N3O4S/c1-32(2,3)25-10-16-28(17-11-25)40(37,38)35-22-29(24-8-6-5-7-9-24)30(23-35)31(36)34-20-18-33(19-21-34)26-12-14-27(39-4)15-13-26/h5-17,29-30H,18-23H2,1-4H3/t29-,30+/m0/s1 |
| InChIKey | XIPHCMUDAYEIMS-XZWHSSHBSA-N |
| XLogP | 4.75 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|