C24H29F3N6O2 — CID 59670513
[2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone (PubChem CID 59670513) has the molecular formula C24H29F3N6O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone.
| Compound Name | [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 59670513 |
| Molecular Formula | C24H29F3N6O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | [2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(OCC(F)(F)F)nc1)N1CCc2cnc(N3CCN(C4CCC4)CC3)nc2CC1 |
| InChI | InChI=1S/C24H29F3N6O2/c25-24(26,27)16-35-21-5-4-18(15-28-21)22(34)32-8-6-17-14-29-23(30-20(17)7-9-32)33-12-10-31(11-13-33)19-2-1-3-19/h4-5,14-15,19H,1-3,6-13,16H2 |
| InChIKey | XRHPELQALJMRBL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |