C22H23ClN4O — CID 59673340
2-amino-4-(3-chloro-2-pyridinyl)-N-[4-(diethylamino)phenyl]benzamide (PubChem CID 59673340) has the molecular formula C22H23ClN4O and a molecular weight of 394.91 g/mol. Its IUPAC name is 2-amino-4-(3-chloro-2-pyridinyl)-N-[4-(diethylamino)phenyl]benzamide.
| Compound Name | 2-amino-4-(3-chloro-2-pyridinyl)-N-[4-(diethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 59673340 |
| Molecular Formula | C22H23ClN4O |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-amino-4-(3-chloro-2-pyridinyl)-N-[4-(diethylamino)phenyl]benzamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccc(-c3ncccc3Cl)cc2N)cc1 |
| InChI | InChI=1S/C22H23ClN4O/c1-3-27(4-2)17-10-8-16(9-11-17)26-22(28)18-12-7-15(14-20(18)24)21-19(23)6-5-13-25-21/h5-14H,3-4,24H2,1-2H3,(H,26,28) |
| InChIKey | BGXPWBAILHSFRM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|