C23H29ClN8O3S2 — CID 59676955
N-[(1R,2S,5S)-2-[[2-[(6-chloropyridazin-3-yl)amino]-2-oxoethanethioyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 59676955) has the molecular formula C23H29ClN8O3S2 and a molecular weight of 565.13 g/mol. Its IUPAC name is N-[(1R,2S,5S)-2-[[2-[(6-chloropyridazin-3-yl)amino]-2-oxoethanethioyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S,5S)-2-[[2-[(6-chloropyridazin-3-yl)amino]-2-oxoethanethioyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59676955 |
| Molecular Formula | C23H29ClN8O3S2 |
| Molecular Weight | 565.13 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | N-[(1R,2S,5S)-2-[[2-[(6-chloropyridazin-3-yl)amino]-2-oxoethanethioyl]amino]-5-(dimethylcarbamoyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CC[C@@H]3NC(=S)C(=O)Nc3ccc(Cl)nn3)sc2C1 |
| InChI | InChI=1S/C23H29ClN8O3S2/c1-31(2)23(35)12-4-5-13(26-21(36)19(33)28-18-7-6-17(24)29-30-18)15(10-12)25-20(34)22-27-14-8-9-32(3)11-16(14)37-22/h6-7,12-13,15H,4-5,8-11H2,1-3H3,(H,25,34)(H,26,36)(H,28,30,33)/t12-,13-,15+/m0/s1 |
| InChIKey | GCCQREWVUXKLQL-KCQAQPDRSA-N |
| XLogP | 1.49 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.13 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|